C21H29N6O5P — CID 156523033
9-[(2R)-2-[[[[(1S)-1-(1,4-dioxan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 156523033) has the molecular formula C21H29N6O5P and a molecular weight of 476.47 g/mol. Its IUPAC name is 9-[(2R)-2-[[[[(1S)-1-(1,4-dioxan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[[[(1S)-1-(1,4-dioxan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 156523033 |
| Molecular Formula | C21H29N6O5P |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 9-[(2R)-2-[[[[(1S)-1-(1,4-dioxan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(N[C@@H](C)C1COCCO1)Oc1ccccc1 |
| InChI | InChI=1S/C21H29N6O5P/c1-15(10-27-13-25-19-20(22)23-12-24-21(19)27)31-14-33(28,32-17-6-4-3-5-7-17)26-16(2)18-11-29-8-9-30-18/h3-7,12-13,15-16,18H,8-11,14H2,1-2H3,(H,26,28)(H2,22,23,24)/t15-,16+,18?,33?/m1/s1 |
| InChIKey | FGKOVMIUGSKRCM-YJTVVGGPSA-N |
| XLogP | 2.44 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|