C20H25N6O6P — CID 166551834
methyl 3-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]oxetane-3-carboxylate (PubChem CID 166551834) has the molecular formula C20H25N6O6P and a molecular weight of 476.43 g/mol. Its IUPAC name is methyl 3-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]oxetane-3-carboxylate.
| Compound Name | methyl 3-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]oxetane-3-carboxylate |
|---|---|
| PubChem CID | 166551834 |
| Molecular Formula | C20H25N6O6P |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 3-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]oxetane-3-carboxylate |
| SMILES | COC(=O)C1(N[P@](=O)(CO[C@H](C)Cn2cnc3c(N)ncnc32)Oc2ccccc2)COC1 |
| InChI | InChI=1S/C20H25N6O6P/c1-14(8-26-12-24-16-17(21)22-11-23-18(16)26)31-13-33(28,32-15-6-4-3-5-7-15)25-20(9-30-10-20)19(27)29-2/h3-7,11-12,14H,8-10,13H2,1-2H3,(H,25,28)(H2,21,22,23)/t14-,33+/m1/s1 |
| InChIKey | NDOAFYGTEJNUSD-GSLRCMBYSA-N |
| XLogP | 1.57 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|