C22H31N6O5P — CID 155408974
9-[2-[[[[1-(1,3-dioxolan-2-yl)-2-methylpropyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 155408974) has the molecular formula C22H31N6O5P and a molecular weight of 490.50 g/mol. Its IUPAC name is 9-[2-[[[[1-(1,3-dioxolan-2-yl)-2-methylpropyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[2-[[[[1-(1,3-dioxolan-2-yl)-2-methylpropyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 155408974 |
| Molecular Formula | C22H31N6O5P |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 9-[2-[[[[1-(1,3-dioxolan-2-yl)-2-methylpropyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(NC(C(C)C)C1OCCO1)Oc1ccccc1 |
| InChI | InChI=1S/C22H31N6O5P/c1-15(2)18(22-30-9-10-31-22)27-34(29,33-17-7-5-4-6-8-17)14-32-16(3)11-28-13-26-19-20(23)24-12-25-21(19)28/h4-8,12-13,15-16,18,22H,9-11,14H2,1-3H3,(H,27,29)(H2,23,24,25) |
| InChIKey | LXYWODZWSFOIEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|