C22H30N5O5P — CID 158388752
3-[(2R)-2-[[[[(1S)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine (PubChem CID 158388752) has the molecular formula C22H30N5O5P and a molecular weight of 475.49 g/mol. Its IUPAC name is 3-[(2R)-2-[[[[(1S)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 3-[(2R)-2-[[[[(1S)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 158388752 |
| Molecular Formula | C22H30N5O5P |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[(2R)-2-[[[[(1S)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine |
| SMILES | CC[C@H](NP(=O)(CO[C@H](C)Cn1cnc2c(N)ccnc21)Oc1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C22H30N5O5P/c1-3-19(22-29-11-12-30-22)26-33(28,32-17-7-5-4-6-8-17)15-31-16(2)13-27-14-25-20-18(23)9-10-24-21(20)27/h4-10,14,16,19,22H,3,11-13,15H2,1-2H3,(H2,23,24)(H,26,28)/t16-,19+,33?/m1/s1 |
| InChIKey | VKQWKUJWTAKBPU-MDBKQVQPSA-N |
| XLogP | 3.39 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|