C22H27N6O9P — CID 138556306
2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoic acid;(E)-but-2-enedioic acid (PubChem CID 138556306) has the molecular formula C22H27N6O9P and a molecular weight of 550.47 g/mol. Its IUPAC name is 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoic acid;(E)-but-2-enedioic acid.
| Compound Name | 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoic acid;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 138556306 |
| Molecular Formula | C22H27N6O9P |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoic acid;(E)-but-2-enedioic acid |
| SMILES | CC(NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1)C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H23N6O5P.C4H4O4/c1-12(8-24-10-22-15-16(19)20-9-21-17(15)24)28-11-30(27,23-13(2)18(25)26)29-14-6-4-3-5-7-14;5-3(6)1-2-4(7)8/h3-7,9-10,12-13H,8,11H2,1-2H3,(H,23,27)(H,25,26)(H2,19,20,21);1-2H,(H,5,6)(H,7,8)/b;2-1+/t12-,13?,30?;/m1./s1 |
| InChIKey | ZIRBFYXBPRJBLR-UMYPYVQESA-N |
| XLogP | 1.82 |
| TPSA | 229.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|