C25H32N5O10P — CID 146473292
4-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-phenoxyphosphoryl]oxy-2,2-dimethylbutanoic acid;(E)-but-2-enedioic acid (PubChem CID 146473292) has the molecular formula C25H32N5O10P and a molecular weight of 593.53 g/mol. Its IUPAC name is 4-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-phenoxyphosphoryl]oxy-2,2-dimethylbutanoic acid;(E)-but-2-enedioic acid.
| Compound Name | 4-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-phenoxyphosphoryl]oxy-2,2-dimethylbutanoic acid;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 146473292 |
| Molecular Formula | C25H32N5O10P |
| Molecular Weight | 593.53 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 4-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-phenoxyphosphoryl]oxy-2,2-dimethylbutanoic acid;(E)-but-2-enedioic acid |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(OCCC(C)(C)C(=O)O)Oc1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H28N5O6P.C4H4O4/c1-15(11-26-13-25-17-18(22)23-12-24-19(17)26)30-14-33(29,32-16-7-5-4-6-8-16)31-10-9-21(2,3)20(27)28;5-3(6)1-2-4(7)8/h4-8,12-13,15H,9-11,14H2,1-3H3,(H,27,28)(H2,22,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OGGCDXVPMRDFOM-WLHGVMLRSA-N |
| XLogP | 3.27 |
| TPSA | 226.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|