C39H53N6O5P — CID 123150832
N-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]oxyethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123150832) has the molecular formula C39H53N6O5P and a molecular weight of 716.86 g/mol. Its IUPAC name is N-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]oxyethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]oxyethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123150832 |
| Molecular Formula | C39H53N6O5P |
| Molecular Weight | 716.86 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | N-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]oxyethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C39H53N6O5P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-36(46)41-28-29-49-51(47,50-35-25-22-21-23-26-35)33-48-34(2)30-45-32-44-37-38(40)42-31-43-39(37)45/h4-5,7-8,10-11,13-14,16-17,19-23,25-26,31-32,34H,3,6,9,12,15,18,24,27-30,33H2,1-2H3,(H,41,46)(H2,40,42,43)/t34-,51?/m1/s1 |
| InChIKey | FOHFACBMLXTPCX-NEZUFPBNSA-N |
| XLogP | 8.65 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.86 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|