C37H51ClN7O4P — CID 123484121
N-[2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 123484121) has the molecular formula C37H51ClN7O4P and a molecular weight of 724.29 g/mol. Its IUPAC name is N-[2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | N-[2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 123484121 |
| Molecular Formula | C37H51ClN7O4P |
| Molecular Weight | 724.29 g/mol |
| Exact Mass | 723.34 |
| IUPAC Name | N-[2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCNP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H51ClN7O4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-34(46)40-25-26-44-50(47,49-33-23-21-32(38)22-24-33)30-48-31(2)27-45-29-43-35-36(39)41-28-42-37(35)45/h4-5,7-8,10-11,13-14,16-17,21-24,28-29,31H,3,6,9,12,15,18-20,25-27,30H2,1-2H3,(H,40,46)(H,44,47)(H2,39,41,42)/t31-,50?/m1/s1 |
| InChIKey | KBDHVONUBNXXKZ-LVBDECQUSA-N |
| XLogP | 8.32 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.29 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|