C25H28ClN6O5P — CID 5482363
methyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 5482363) has the molecular formula C25H28ClN6O5P and a molecular weight of 558.96 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 5482363 |
| Molecular Formula | C25H28ClN6O5P |
| Molecular Weight | 558.96 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | methyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-chlorophenoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28ClN6O5P/c1-17(13-32-15-30-22-23(27)28-14-29-24(22)32)36-16-38(34,37-20-10-8-19(26)9-11-20)31-21(25(33)35-2)12-18-6-4-3-5-7-18/h3-11,14-15,17,21H,12-13,16H2,1-2H3,(H,31,34)(H2,27,28,29)/t17-,21+,38?/m1/s1 |
| InChIKey | IZEFCOVMCNDCGL-KFWWGUNHSA-N |
| XLogP | 4.07 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|