C22H28F3N6O6P — CID 145420707
propan-2-yl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]-3-(trifluoromethoxy)propanoate (PubChem CID 145420707) has the molecular formula C22H28F3N6O6P and a molecular weight of 560.47 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]-3-(trifluoromethoxy)propanoate.
| Compound Name | propan-2-yl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]-3-(trifluoromethoxy)propanoate |
|---|---|
| PubChem CID | 145420707 |
| Molecular Formula | C22H28F3N6O6P |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | propan-2-yl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]-3-(trifluoromethoxy)propanoate |
| SMILES | CC(C)OC(=O)C(COC(F)(F)F)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C22H28F3N6O6P/c1-14(2)36-21(32)17(10-35-22(23,24)25)30-38(33,37-16-7-5-4-6-8-16)13-34-15(3)9-31-12-29-18-19(26)27-11-28-20(18)31/h4-8,11-12,14-15,17H,9-10,13H2,1-3H3,(H,30,33)(H2,26,27,28)/t15-,17?,38?/m1/s1 |
| InChIKey | ZDWDBJFVQAOXPE-HYCHAJNKSA-N |
| XLogP | 3.49 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|