C29H37N6O7P — CID 150555074
2-(2-phenylmethoxyethoxy)ethyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 150555074) has the molecular formula C29H37N6O7P and a molecular weight of 612.62 g/mol. Its IUPAC name is 2-(2-phenylmethoxyethoxy)ethyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-(2-phenylmethoxyethoxy)ethyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 150555074 |
| Molecular Formula | C29H37N6O7P |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 2-(2-phenylmethoxyethoxy)ethyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(N[C@@H](C)C(=O)OCCOCCOCc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C29H37N6O7P/c1-22(17-35-20-33-26-27(30)31-19-32-28(26)35)41-21-43(37,42-25-11-7-4-8-12-25)34-23(2)29(36)40-16-15-38-13-14-39-18-24-9-5-3-6-10-24/h3-12,19-20,22-23H,13-18,21H2,1-2H3,(H,34,37)(H2,30,31,32)/t22-,23+,43?/m1/s1 |
| InChIKey | IIRDWMBKKNKHFB-QVFNTHSGSA-N |
| XLogP | 3.80 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|