C20H27N6O5P — CID 130441672
propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 130441672) has the molecular formula C20H27N6O5P and a molecular weight of 462.45 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130441672 |
| Molecular Formula | C20H27N6O5P |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(COCCn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C20H27N6O5P/c1-14(2)30-20(27)15(3)25-32(28,31-16-7-5-4-6-8-16)13-29-10-9-26-12-24-17-18(21)22-11-23-19(17)26/h4-8,11-12,14-15H,9-10,13H2,1-3H3,(H,25,28)(H2,21,22,23) |
| InChIKey | ZBLCZUWQCGNTJF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|