C21H27N6O7P — CID 152908483
propan-2-yl (2R)-2-[[[(2R)-1-(6-nitropurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 152908483) has the molecular formula C21H27N6O7P and a molecular weight of 506.46 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R)-1-(6-nitropurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R)-1-(6-nitropurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 152908483 |
| Molecular Formula | C21H27N6O7P |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R)-1-(6-nitropurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@](=O)(CO[C@H](C)Cn1cnc2c([N+](=O)[O-])ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C21H27N6O7P/c1-14(2)33-21(28)16(4)25-35(31,34-17-8-6-5-7-9-17)13-32-15(3)10-26-12-24-18-19(26)22-11-23-20(18)27(29)30/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,25,31)/t15-,16-,35+/m1/s1 |
| InChIKey | UGSLOFNDSVOPQD-KSMDVAPZSA-N |
| XLogP | 3.30 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|