C17H29N6O5P — CID 163197549
propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphoryl]amino]propanoate (PubChem CID 163197549) has the molecular formula C17H29N6O5P and a molecular weight of 428.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163197549 |
| Molecular Formula | C17H29N6O5P |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphoryl]amino]propanoate |
| SMILES | CCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)N[C@@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C17H29N6O5P/c1-6-27-29(25,22-13(5)17(24)28-11(2)3)10-26-12(4)7-23-9-21-14-15(18)19-8-20-16(14)23/h8-9,11-13H,6-7,10H2,1-5H3,(H,22,25)(H2,18,19,20)/t12-,13+,29?/m1/s1 |
| InChIKey | UTHZIIDNGDENLL-OPGNBLEVSA-N |
| XLogP | 1.93 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|