C21H33N6O5P — CID 143073094
propan-2-yl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphosphoryl]amino]propanoate (PubChem CID 143073094) has the molecular formula C21H33N6O5P and a molecular weight of 480.51 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 143073094 |
| Molecular Formula | C21H33N6O5P |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphosphoryl]amino]propanoate |
| SMILES | C/C=C\C(=C/C)OP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)N[C@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C21H33N6O5P/c1-7-9-17(8-2)32-33(29,26-16(6)21(28)31-14(3)4)13-30-15(5)10-27-12-25-18-19(22)23-11-24-20(18)27/h7-9,11-12,14-16H,10,13H2,1-6H3,(H,26,29)(H2,22,23,24)/b9-7-,17-8+/t15-,16-,33?/m1/s1 |
| InChIKey | BBMMZXKUEUTVDG-WBIUGEIMSA-N |
| XLogP | 3.39 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|