C22H38N7O6P — CID 166551597
butyl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 166551597) has the molecular formula C22H38N7O6P and a molecular weight of 527.56 g/mol. Its IUPAC name is butyl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | butyl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166551597 |
| Molecular Formula | C22H38N7O6P |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | butyl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@@H](C)N[P@@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)N[C@@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C22H38N7O6P/c1-7-8-9-33-21(30)16(5)27-36(32,28-17(6)22(31)35-14(2)3)13-34-15(4)10-29-12-26-18-19(23)24-11-25-20(18)29/h11-12,14-17H,7-10,13H2,1-6H3,(H2,23,24,25)(H2,27,28,32)/t15-,16-,17+,36+/m1/s1 |
| InChIKey | NXOUFNBOGVJSRS-DDKUZVKCSA-N |
| XLogP | 2.22 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|