C25H44N7O6P — CID 137360775
hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 137360775) has the molecular formula C25H44N7O6P and a molecular weight of 569.64 g/mol. Its IUPAC name is hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 137360775 |
| Molecular Formula | C25H44N7O6P |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)N[P@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)N[C@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C25H44N7O6P/c1-8-9-10-11-12-36-24(34)25(6,7)31-39(35,30-19(5)23(33)38-17(2)3)16-37-18(4)13-32-15-29-20-21(26)27-14-28-22(20)32/h14-15,17-19H,8-13,16H2,1-7H3,(H2,26,27,28)(H2,30,31,35)/t18-,19-,39+/m1/s1 |
| InChIKey | FWIGELPVGITBHN-IKEAKFGNSA-N |
| XLogP | 3.39 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|