C28H50N7O6P — CID 170349755
propan-2-yl 3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate (PubChem CID 170349755) has the molecular formula C28H50N7O6P and a molecular weight of 611.73 g/mol. Its IUPAC name is propan-2-yl 3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate.
| Compound Name | propan-2-yl 3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 170349755 |
| Molecular Formula | C28H50N7O6P |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | propan-2-yl 3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(COC(C)Cn1cnc2c(N)ncnc21)NC(CC(=O)OC(C)C)C(C)C |
| InChI | InChI=1S/C28H50N7O6P/c1-9-10-11-12-13-39-27(37)28(7,8)34-42(38,33-22(19(2)3)14-23(36)41-20(4)5)18-40-21(6)15-35-17-32-24-25(29)30-16-31-26(24)35/h16-17,19-22H,9-15,18H2,1-8H3,(H2,29,30,31)(H2,33,34,38) |
| InChIKey | ANEGPHGLCMCBMI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|