C25H43N6O7P — CID 134284266
hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 134284266) has the molecular formula C25H43N6O7P and a molecular weight of 570.63 g/mol. Its IUPAC name is hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 134284266 |
| Molecular Formula | C25H43N6O7P |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)O[C@@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C25H43N6O7P/c1-8-9-10-11-12-35-24(33)25(6,7)30-39(34,38-19(5)23(32)37-17(2)3)16-36-18(4)13-31-15-29-20-21(26)27-14-28-22(20)31/h14-15,17-19H,8-13,16H2,1-7H3,(H,30,34)(H2,26,27,28)/t18-,19+,39?/m1/s1 |
| InChIKey | SCUUWTXXRNLCKY-SACLDIGCSA-N |
| XLogP | 3.81 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|