C31H47N6O7P — CID 134284337
hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(1-oxo-3-phenyl-1-propan-2-yloxypropan-2-yl)oxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 134284337) has the molecular formula C31H47N6O7P and a molecular weight of 646.73 g/mol. Its IUPAC name is hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(1-oxo-3-phenyl-1-propan-2-yloxypropan-2-yl)oxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(1-oxo-3-phenyl-1-propan-2-yloxypropan-2-yl)oxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 134284337 |
| Molecular Formula | C31H47N6O7P |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(1-oxo-3-phenyl-1-propan-2-yloxypropan-2-yl)oxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(COC(C)Cn1cnc2c(N)ncnc21)OC(Cc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C31H47N6O7P/c1-7-8-9-13-16-41-30(39)31(5,6)36-45(40,44-25(29(38)43-22(2)3)17-24-14-11-10-12-15-24)21-42-23(4)18-37-20-35-26-27(32)33-19-34-28(26)37/h10-12,14-15,19-20,22-23,25H,7-9,13,16-18,21H2,1-6H3,(H,36,40)(H2,32,33,34) |
| InChIKey | JACMTQRPMLREHA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|