C24H41N6O7P — CID 134816720
hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-2-methylpropanoate (PubChem CID 134816720) has the molecular formula C24H41N6O7P and a molecular weight of 556.60 g/mol. Its IUPAC name is hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 134816720 |
| Molecular Formula | C24H41N6O7P |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCC(=O)OC(C)C |
| InChI | InChI=1S/C24H41N6O7P/c1-7-8-9-10-11-34-23(32)24(5,6)29-38(33,36-13-19(31)37-17(2)3)16-35-18(4)12-30-15-28-20-21(25)26-14-27-22(20)30/h14-15,17-18H,7-13,16H2,1-6H3,(H,29,33)(H2,25,26,27)/t18-,38?/m1/s1 |
| InChIKey | KBWCFMXHNHIITE-CSTFOYFXSA-N |
| XLogP | 3.42 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|