C23H39N6O7P — CID 176870161
butyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 176870161) has the molecular formula C23H39N6O7P and a molecular weight of 542.57 g/mol. Its IUPAC name is butyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | butyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 176870161 |
| Molecular Formula | C23H39N6O7P |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | butyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]oxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)N[P@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)O[C@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C23H39N6O7P/c1-8-9-10-33-22(31)23(6,7)28-37(32,36-17(5)21(30)35-15(2)3)14-34-16(4)11-29-13-27-18-19(24)25-12-26-20(18)29/h12-13,15-17H,8-11,14H2,1-7H3,(H,28,32)(H2,24,25,26)/t16-,17-,37+/m1/s1 |
| InChIKey | NXRAKWXSVRLINQ-ZNLSZHTKSA-N |
| XLogP | 3.03 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|