C24H40N7O5P — CID 129248967
hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentylideneamino)oxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 129248967) has the molecular formula C24H40N7O5P and a molecular weight of 537.60 g/mol. Its IUPAC name is hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentylideneamino)oxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentylideneamino)oxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 129248967 |
| Molecular Formula | C24H40N7O5P |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | hexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(cyclopentylideneamino)oxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)N[P@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)ON=C1CCCC1 |
| InChI | InChI=1S/C24H40N7O5P/c1-5-6-7-10-13-34-23(32)24(3,4)30-37(33,36-29-19-11-8-9-12-19)17-35-18(2)14-31-16-28-20-21(25)26-15-27-22(20)31/h15-16,18H,5-14,17H2,1-4H3,(H,30,33)(H2,25,26,27)/t18-,37+/m1/s1 |
| InChIKey | AJJPRIXEGWTTJA-OZQPHIFRSA-N |
| XLogP | 4.40 |
| TPSA | 155.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|