C22H38N7O6P — CID 126568789
(3S)-3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]phosphoryl]amino]butanoic acid (PubChem CID 126568789) has the molecular formula C22H38N7O6P and a molecular weight of 527.56 g/mol. Its IUPAC name is (3S)-3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]phosphoryl]amino]butanoic acid.
| Compound Name | (3S)-3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]phosphoryl]amino]butanoic acid |
|---|---|
| PubChem CID | 126568789 |
| Molecular Formula | C22H38N7O6P |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (3S)-3-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]phosphoryl]amino]butanoic acid |
| SMILES | CCCCCOC(=O)C(C)(C)N[P@@](=O)(COC(C)Cn1cnc2c(N)ncnc21)N[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C22H38N7O6P/c1-6-7-8-9-34-21(32)22(4,5)28-36(33,27-15(2)10-17(30)31)14-35-16(3)11-29-13-26-18-19(23)24-12-25-20(18)29/h12-13,15-16H,6-11,14H2,1-5H3,(H,30,31)(H2,23,24,25)(H2,27,28,33)/t15-,16?,36+/m0/s1 |
| InChIKey | SKPZDDAJNWTBSG-FNGDYHJUSA-N |
| XLogP | 2.52 |
| TPSA | 183.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|