C23H34N7O5PS — CID 139431338
pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(thiophene-2-carbonylamino)phosphoryl]amino]-2-methylpropanoate (PubChem CID 139431338) has the molecular formula C23H34N7O5PS and a molecular weight of 551.61 g/mol. Its IUPAC name is pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(thiophene-2-carbonylamino)phosphoryl]amino]-2-methylpropanoate.
| Compound Name | pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(thiophene-2-carbonylamino)phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 139431338 |
| Molecular Formula | C23H34N7O5PS |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(thiophene-2-carbonylamino)phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCOC(=O)C(C)(C)N[P@@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)NC(=O)c1cccs1 |
| InChI | InChI=1S/C23H34N7O5PS/c1-5-6-7-10-34-22(32)23(3,4)29-36(33,28-21(31)17-9-8-11-37-17)15-35-16(2)12-30-14-27-18-19(24)25-13-26-20(18)30/h8-9,11,13-14,16H,5-7,10,12,15H2,1-4H3,(H2,24,25,26)(H2,28,29,31,33)/t16-,36-/m1/s1 |
| InChIKey | WCTYKLLZDWTMJG-CUPYOXQXSA-N |
| XLogP | 3.56 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|