C29H52N7O6P — CID 162724718
hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 162724718) has the molecular formula C29H52N7O6P and a molecular weight of 625.75 g/mol. Its IUPAC name is hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 162724718 |
| Molecular Formula | C29H52N7O6P |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.37 |
| IUPAC Name | hexyl 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(COC(C)Cn1cnc2c(N)ncnc21)NC(C)(C)C(=O)OCCCCCC |
| InChI | InChI=1S/C29H52N7O6P/c1-8-10-12-14-16-40-26(37)28(4,5)34-43(39,35-29(6,7)27(38)41-17-15-13-11-9-2)21-42-22(3)18-36-20-33-23-24(30)31-19-32-25(23)36/h19-20,22H,8-18,21H2,1-7H3,(H2,30,31,32)(H2,34,35,39) |
| InChIKey | IHPXPBXOELKOEM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|