C27H48N7O6P — CID 137360804
pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[methyl-[(2R)-1-oxo-1-pentoxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 137360804) has the molecular formula C27H48N7O6P and a molecular weight of 597.70 g/mol. Its IUPAC name is pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[methyl-[(2R)-1-oxo-1-pentoxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[methyl-[(2R)-1-oxo-1-pentoxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 137360804 |
| Molecular Formula | C27H48N7O6P |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[methyl-[(2R)-1-oxo-1-pentoxypropan-2-yl]amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCOC(=O)[C@@H](C)N(C)P(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)NC(C)(C)C(=O)OCCCCC |
| InChI | InChI=1S/C27H48N7O6P/c1-8-10-12-14-38-25(35)21(4)33(7)41(37,32-27(5,6)26(36)39-15-13-11-9-2)19-40-20(3)16-34-18-31-22-23(28)29-17-30-24(22)34/h17-18,20-21H,8-16,19H2,1-7H3,(H,32,37)(H2,28,29,30)/t20-,21-,41?/m1/s1 |
| InChIKey | FLCSMXNDZSGVAX-XMIJLCFSSA-N |
| XLogP | 4.12 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|