C15H24LiN6O5P — CID 175674530
lithium [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphinate (PubChem CID 175674530) has the molecular formula C15H24LiN6O5P and a molecular weight of 406.31 g/mol. Its IUPAC name is lithium [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphinate.
| Compound Name | lithium [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphinate |
|---|---|
| PubChem CID | 175674530 |
| Molecular Formula | C15H24LiN6O5P |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | lithium [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphinate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)([O-])CO[C@H](C)Cn1cnc2c(N)ncnc21.[Li+] |
| InChI | InChI=1S/C15H25N6O5P.Li/c1-9(2)26-15(22)11(4)20-27(23,24)8-25-10(3)5-21-7-19-12-13(16)17-6-18-14(12)21;/h6-7,9-11H,5,8H2,1-4H3,(H2,16,17,18)(H2,20,23,24);/q;+1/p-1/t10-,11+;/m1./s1 |
| InChIKey | XQRXFGWVRUDSNI-DHXVBOOMSA-M |
| XLogP | -2.74 |
| TPSA | 157.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|