C26H42N7O5P — CID 129270360
propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dicyclopentylmethylideneamino)oxyphosphoryl]amino]propanoate (PubChem CID 129270360) has the molecular formula C26H42N7O5P and a molecular weight of 563.64 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dicyclopentylmethylideneamino)oxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dicyclopentylmethylideneamino)oxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129270360 |
| Molecular Formula | C26H42N7O5P |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(dicyclopentylmethylideneamino)oxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)ON=C(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C26H42N7O5P/c1-17(2)37-26(34)19(4)32-39(35,38-31-22(20-9-5-6-10-20)21-11-7-8-12-21)16-36-18(3)13-33-15-30-23-24(27)28-14-29-25(23)33/h14-15,17-21H,5-13,16H2,1-4H3,(H,32,35)(H2,27,28,29)/t18-,19+,39?/m1/s1 |
| InChIKey | FPWUSDTXAWDDPE-SACLDIGCSA-N |
| XLogP | 4.65 |
| TPSA | 155.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|