C17H27N6O5P — CID 126568925
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-N-[(2R)-1-cyclopentyloxy-1-oxopropan-2-yl]phosphonamidic acid (PubChem CID 126568925) has the molecular formula C17H27N6O5P and a molecular weight of 426.41 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-N-[(2R)-1-cyclopentyloxy-1-oxopropan-2-yl]phosphonamidic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-N-[(2R)-1-cyclopentyloxy-1-oxopropan-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 126568925 |
| Molecular Formula | C17H27N6O5P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-N-[(2R)-1-cyclopentyloxy-1-oxopropan-2-yl]phosphonamidic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)N[C@H](C)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C17H27N6O5P/c1-11(7-23-9-21-14-15(18)19-8-20-16(14)23)27-10-29(25,26)22-12(2)17(24)28-13-5-3-4-6-13/h8-9,11-13H,3-7,10H2,1-2H3,(H2,18,19,20)(H2,22,25,26)/t11-,12-/m1/s1 |
| InChIKey | ZMACPSGYMPGMNT-VXGBXAGGSA-N |
| XLogP | 1.42 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|