C19H28N7O5P — CID 137359253
2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(dicyclopropylmethylideneamino)oxyphosphoryl]amino]propanoic acid (PubChem CID 137359253) has the molecular formula C19H28N7O5P and a molecular weight of 465.45 g/mol. Its IUPAC name is 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(dicyclopropylmethylideneamino)oxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(dicyclopropylmethylideneamino)oxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 137359253 |
| Molecular Formula | C19H28N7O5P |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(dicyclopropylmethylideneamino)oxyphosphoryl]amino]propanoic acid |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(NC(C)C(=O)O)ON=C(C1CC1)C1CC1 |
| InChI | InChI=1S/C19H28N7O5P/c1-11(7-26-9-23-16-17(20)21-8-22-18(16)26)30-10-32(29,25-12(2)19(27)28)31-24-15(13-3-4-13)14-5-6-14/h8-9,11-14H,3-7,10H2,1-2H3,(H,25,29)(H,27,28)(H2,20,21,22) |
| InChIKey | OAUWPVBSCNIKBX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|