C22H28N7O5P — CID 137359232
(2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]oxyphosphoryl]amino]propanoic acid (PubChem CID 137359232) has the molecular formula C22H28N7O5P and a molecular weight of 501.48 g/mol. Its IUPAC name is (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]oxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]oxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 137359232 |
| Molecular Formula | C22H28N7O5P |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]oxyphosphoryl]amino]propanoic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(N[C@@H](C)C(=O)O)O/N=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C22H28N7O5P/c1-14(10-29-12-26-19-20(23)24-11-25-21(19)29)33-13-35(32,28-15(2)22(30)31)34-27-18-9-5-7-16-6-3-4-8-17(16)18/h3-4,6,8,11-12,14-15H,5,7,9-10,13H2,1-2H3,(H,28,32)(H,30,31)(H2,23,24,25)/b27-18+/t14-,15+,35?/m1/s1 |
| InChIKey | NYRFEPIDPMEFFW-XBRGHESUSA-N |
| XLogP | 2.78 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|