C25H29N6O5P — CID 134490297
benzyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenylmethoxyphosphoryl]amino]acetate (PubChem CID 134490297) has the molecular formula C25H29N6O5P and a molecular weight of 524.52 g/mol. Its IUPAC name is benzyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenylmethoxyphosphoryl]amino]acetate.
| Compound Name | benzyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenylmethoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 134490297 |
| Molecular Formula | C25H29N6O5P |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | benzyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenylmethoxyphosphoryl]amino]acetate |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OC[P@@](=O)(NCC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H29N6O5P/c1-19(13-31-17-29-23-24(26)27-16-28-25(23)31)35-18-37(33,36-15-21-10-6-3-7-11-21)30-12-22(32)34-14-20-8-4-2-5-9-20/h2-11,16-17,19H,12-15,18H2,1H3,(H,30,33)(H2,26,27,28)/t19-,37+/m1/s1 |
| InChIKey | NDOGADWVVYOATI-JGEXTMCWSA-N |
| XLogP | 3.51 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|