C22H31N6O4P — CID 126629594
propan-2-yl (2S)-2-[[[(3S)-4-(6-aminopurin-9-yl)-3-methylbutyl]-phenoxyphosphoryl]amino]propanoate (PubChem CID 126629594) has the molecular formula C22H31N6O4P and a molecular weight of 474.50 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(3S)-4-(6-aminopurin-9-yl)-3-methylbutyl]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(3S)-4-(6-aminopurin-9-yl)-3-methylbutyl]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126629594 |
| Molecular Formula | C22H31N6O4P |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(3S)-4-(6-aminopurin-9-yl)-3-methylbutyl]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(CC[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C22H31N6O4P/c1-15(2)31-22(29)17(4)27-33(30,32-18-8-6-5-7-9-18)11-10-16(3)12-28-14-26-19-20(23)24-13-25-21(19)28/h5-9,13-17H,10-12H2,1-4H3,(H,27,30)(H2,23,24,25)/t16-,17-,33?/m0/s1 |
| InChIKey | GKAIJDSLWDRCLK-TUBSDBEDSA-N |
| XLogP | 3.64 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|