C20H25N6O5P — CID 134219056
prop-2-enyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134219056) has the molecular formula C20H25N6O5P and a molecular weight of 460.43 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | prop-2-enyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134219056 |
| Molecular Formula | C20H25N6O5P |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | prop-2-enyl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=CCOC(=O)[C@H](C)N[P@@](=O)(Oc1ccccc1)O[C@H](C)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H25N6O5P/c1-4-10-29-20(27)15(3)25-32(28,31-16-8-6-5-7-9-16)30-14(2)11-26-13-24-17-18(21)22-12-23-19(17)26/h4-9,12-15H,1,10-11H2,2-3H3,(H,25,28)(H2,21,22,23)/t14-,15+,32+/m1/s1 |
| InChIKey | RHKPMUCNKDDYKP-CZVZCILPSA-N |
| XLogP | 2.71 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|