C23H37N6O5P — CID 166551600
ethane;propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]acetate (PubChem CID 166551600) has the molecular formula C23H37N6O5P and a molecular weight of 508.56 g/mol. Its IUPAC name is ethane;propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]acetate.
| Compound Name | ethane;propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 166551600 |
| Molecular Formula | C23H37N6O5P |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | ethane;propan-2-yl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]acetate |
| SMILES | CC.CC.CC(C)OC(=O)CNP(=O)(COCCn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C19H25N6O5P.2C2H6/c1-14(2)29-16(26)10-24-31(27,30-15-6-4-3-5-7-15)13-28-9-8-25-12-23-17-18(20)21-11-22-19(17)25;2*1-2/h3-7,11-12,14H,8-10,13H2,1-2H3,(H,24,27)(H2,20,21,22);2*1-2H3 |
| InChIKey | GRILVZYCIQMVAZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|