C24H31N5O10P2 — CID 70674498
9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;phosphoric acid (PubChem CID 70674498) has the molecular formula C24H31N5O10P2 and a molecular weight of 611.49 g/mol. Its IUPAC name is 9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;phosphoric acid.
| Compound Name | 9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;phosphoric acid |
|---|---|
| PubChem CID | 70674498 |
| Molecular Formula | C24H31N5O10P2 |
| Molecular Weight | 611.49 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | 9-[2-[bis(2-ethoxyphenoxy)phosphorylmethoxy]ethyl]purin-6-amine;phosphoric acid |
| SMILES | CCOc1ccccc1OP(=O)(COCCn1cnc2c(N)ncnc21)Oc1ccccc1OCC.O=P(O)(O)O |
| InChI | InChI=1S/C24H28N5O6P.H3O4P/c1-3-32-18-9-5-7-11-20(18)34-36(30,35-21-12-8-6-10-19(21)33-4-2)17-31-14-13-29-16-28-22-23(25)26-15-27-24(22)29;1-5(2,3)4/h5-12,15-16H,3-4,13-14,17H2,1-2H3,(H2,25,26,27);(H3,1,2,3,4) |
| InChIKey | GEUVQLYXGMKWDP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 210.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|