C26H28N5O10P — CID 24779748
[2-(6-aminopurin-9-yl)ethoxymethyl-(phenylmethoxycarbonyloxymethoxy)phosphoryl]oxymethyl benzyl carbonate (PubChem CID 24779748) has the molecular formula C26H28N5O10P and a molecular weight of 601.51 g/mol. Its IUPAC name is [2-(6-aminopurin-9-yl)ethoxymethyl-(phenylmethoxycarbonyloxymethoxy)phosphoryl]oxymethyl benzyl carbonate.
| Compound Name | [2-(6-aminopurin-9-yl)ethoxymethyl-(phenylmethoxycarbonyloxymethoxy)phosphoryl]oxymethyl benzyl carbonate |
|---|---|
| PubChem CID | 24779748 |
| Molecular Formula | C26H28N5O10P |
| Molecular Weight | 601.51 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | [2-(6-aminopurin-9-yl)ethoxymethyl-(phenylmethoxycarbonyloxymethoxy)phosphoryl]oxymethyl benzyl carbonate |
| SMILES | Nc1ncnc2c1ncn2CCOCP(=O)(OCOC(=O)OCc1ccccc1)OCOC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H28N5O10P/c27-23-22-24(29-15-28-23)31(16-30-22)11-12-35-19-42(34,40-17-38-25(32)36-13-20-7-3-1-4-8-20)41-18-39-26(33)37-14-21-9-5-2-6-10-21/h1-10,15-16H,11-14,17-19H2,(H2,27,28,29) |
| InChIKey | ALTLGJKPEBYNFG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 185.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|