C8H12N5O3PS — CID 54577179
9-[2-(dihydroxyphosphinothioylmethoxy)ethyl]purin-6-amine (PubChem CID 54577179) has the molecular formula C8H12N5O3PS and a molecular weight of 289.26 g/mol. Its IUPAC name is 9-[2-(dihydroxyphosphinothioylmethoxy)ethyl]purin-6-amine.
| Compound Name | 9-[2-(dihydroxyphosphinothioylmethoxy)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 54577179 |
| Molecular Formula | C8H12N5O3PS |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 9-[2-(dihydroxyphosphinothioylmethoxy)ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCOCP(O)(O)=S |
| InChI | InChI=1S/C8H12N5O3PS/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-16-5-17(14,15)18/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,18) |
| InChIKey | HUXZXCILZRCOPF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|