C22H24N5O4P — CID 10389201
9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]purin-6-amine (PubChem CID 10389201) has the molecular formula C22H24N5O4P and a molecular weight of 453.44 g/mol. Its IUPAC name is 9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]purin-6-amine.
| Compound Name | 9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 10389201 |
| Molecular Formula | C22H24N5O4P |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCOCP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H24N5O4P/c23-21-20-22(25-15-24-21)27(16-26-20)11-12-29-17-32(28,30-13-18-7-3-1-4-8-18)31-14-19-9-5-2-6-10-19/h1-10,15-16H,11-14,17H2,(H2,23,24,25) |
| InChIKey | KQNUEMYJDNIOKC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|