C8H13N5NaO4P — CID 175088142
sodium;2-(6-aminopurin-9-yl)ethoxymethylphosphonic acid;hydride (PubChem CID 175088142) has the molecular formula C8H13N5NaO4P and a molecular weight of 297.19 g/mol. Its IUPAC name is sodium;2-(6-aminopurin-9-yl)ethoxymethylphosphonic acid;hydride.
| Compound Name | sodium;2-(6-aminopurin-9-yl)ethoxymethylphosphonic acid;hydride |
|---|---|
| PubChem CID | 175088142 |
| Molecular Formula | C8H13N5NaO4P |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | sodium;2-(6-aminopurin-9-yl)ethoxymethylphosphonic acid;hydride |
| SMILES | Nc1ncnc2c1ncn2CCOCP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C8H12N5O4P.Na.H/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-17-5-18(14,15)16;;/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,16);;/q;+1;-1 |
| InChIKey | SZNBVWGTPMFUEZ-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|