C14H22N5O5PS — CID 10621184
2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2-methylpropanoylsulfanyl)ethoxy]phosphinic acid (PubChem CID 10621184) has the molecular formula C14H22N5O5PS and a molecular weight of 403.40 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2-methylpropanoylsulfanyl)ethoxy]phosphinic acid.
| Compound Name | 2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2-methylpropanoylsulfanyl)ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 10621184 |
| Molecular Formula | C14H22N5O5PS |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2-methylpropanoylsulfanyl)ethoxy]phosphinic acid |
| SMILES | CC(C)C(=O)SCCOP(=O)(O)COCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H22N5O5PS/c1-10(2)14(20)26-6-5-24-25(21,22)9-23-4-3-19-8-18-11-12(15)16-7-17-13(11)19/h7-8,10H,3-6,9H2,1-2H3,(H,21,22)(H2,15,16,17) |
| InChIKey | VOPTYCZGMILIAW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|