C15H24N5O5PS — CID 10716856
2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinic acid (PubChem CID 10716856) has the molecular formula C15H24N5O5PS and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinic acid.
| Compound Name | 2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 10716856 |
| Molecular Formula | C15H24N5O5PS |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-(6-aminopurin-9-yl)ethoxymethyl-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinic acid |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(O)COCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H24N5O5PS/c1-15(2,3)14(21)27-7-6-25-26(22,23)10-24-5-4-20-9-19-11-12(16)17-8-18-13(11)20/h8-9H,4-7,10H2,1-3H3,(H,22,23)(H2,16,17,18) |
| InChIKey | LTMYCCVKXJAQCZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|