C20H34N7O6P — CID 24905665
ethyl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-[(1-ethoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 24905665) has the molecular formula C20H34N7O6P and a molecular weight of 499.51 g/mol. Its IUPAC name is ethyl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-[(1-ethoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-[(1-ethoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 24905665 |
| Molecular Formula | C20H34N7O6P |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | ethyl 2-[[2-(6-aminopurin-9-yl)ethoxymethyl-[(1-ethoxy-2-methyl-1-oxopropan-2-yl)amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NP(=O)(COCCn1cnc2c(N)ncnc21)NC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C20H34N7O6P/c1-7-32-17(28)19(3,4)25-34(30,26-20(5,6)18(29)33-8-2)13-31-10-9-27-12-24-14-15(21)22-11-23-16(14)27/h11-12H,7-10,13H2,1-6H3,(H2,21,22,23)(H2,25,26,30) |
| InChIKey | ZXKJCEGOEPFDOD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|