C15H26N7O5P — CID 167044597
ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(methylamino)phosphoryl]amino]-2-methylpropanoate (PubChem CID 167044597) has the molecular formula C15H26N7O5P and a molecular weight of 415.39 g/mol. Its IUPAC name is ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(methylamino)phosphoryl]amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(methylamino)phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 167044597 |
| Molecular Formula | C15H26N7O5P |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(methylamino)phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)NC |
| InChI | InChI=1S/C15H26N7O5P/c1-5-27-13(24)15(2,3)21-28(25,17-4)9-26-7-6-22-8-18-10-11(22)19-14(16)20-12(10)23/h8H,5-7,9H2,1-4H3,(H2,17,21,25)(H3,16,19,20,23) |
| InChIKey | CKYVOKNUWAGCNU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 166.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|