C18H30N7O9P — CID 137002257
[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(2S)-2-(ethoxyamino)propanoyl]oxyphosphoryl] (2S)-2-(ethoxyamino)propanoate (PubChem CID 137002257) has the molecular formula C18H30N7O9P and a molecular weight of 519.45 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(2S)-2-(ethoxyamino)propanoyl]oxyphosphoryl] (2S)-2-(ethoxyamino)propanoate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(2S)-2-(ethoxyamino)propanoyl]oxyphosphoryl] (2S)-2-(ethoxyamino)propanoate |
|---|---|
| PubChem CID | 137002257 |
| Molecular Formula | C18H30N7O9P |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(2S)-2-(ethoxyamino)propanoyl]oxyphosphoryl] (2S)-2-(ethoxyamino)propanoate |
| SMILES | CCON[C@@H](C)C(=O)OP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OC(=O)[C@H](C)NOCC |
| InChI | InChI=1S/C18H30N7O9P/c1-5-31-23-11(3)16(27)33-35(29,34-17(28)12(4)24-32-6-2)10-30-8-7-25-9-20-13-14(25)21-18(19)22-15(13)26/h9,11-12,23-24H,5-8,10H2,1-4H3,(H3,19,21,22,26)/t11-,12-/m0/s1 |
| InChIKey | HJBNXZMEABVHPZ-RYUDHWBXSA-N |
| XLogP | -0.19 |
| TPSA | 211.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|