C16H26N7O6P — CID 163497502
methyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-3-oxobutan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 163497502) has the molecular formula C16H26N7O6P and a molecular weight of 443.40 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-3-oxobutan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-3-oxobutan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163497502 |
| Molecular Formula | C16H26N7O6P |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-3-oxobutan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)N[C@@H](C)C(C)=O |
| InChI | InChI=1S/C16H26N7O6P/c1-9(11(3)24)21-30(27,22-10(2)15(26)28-4)8-29-6-5-23-7-18-12-13(23)19-16(17)20-14(12)25/h7,9-10H,5-6,8H2,1-4H3,(H2,21,22,27)(H3,17,19,20,25)/t9-,10+,30?/m0/s1 |
| InChIKey | ACIYPRVLYJZSGC-ZLOQUGDKSA-N |
| XLogP | -0.41 |
| TPSA | 183.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|