C11H18N5O6P — CID 136953841
2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methoxyethoxy)phosphinic acid (PubChem CID 136953841) has the molecular formula C11H18N5O6P and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methoxyethoxy)phosphinic acid.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methoxyethoxy)phosphinic acid |
|---|---|
| PubChem CID | 136953841 |
| Molecular Formula | C11H18N5O6P |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methoxyethoxy)phosphinic acid |
| SMILES | COCCOP(=O)(O)COCCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H18N5O6P/c1-20-4-5-22-23(18,19)7-21-3-2-16-6-13-8-9(16)14-11(12)15-10(8)17/h6H,2-5,7H2,1H3,(H,18,19)(H3,12,14,15,17) |
| InChIKey | VCNUSZUOZPCSPI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|