C14H18N5O7P — CID 136953531
2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methyl-2-oxo-3H-furan-5-yl)methoxy]phosphinic acid (PubChem CID 136953531) has the molecular formula C14H18N5O7P and a molecular weight of 399.30 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methyl-2-oxo-3H-furan-5-yl)methoxy]phosphinic acid.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methyl-2-oxo-3H-furan-5-yl)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 136953531 |
| Molecular Formula | C14H18N5O7P |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methyl-2-oxo-3H-furan-5-yl)methoxy]phosphinic acid |
| SMILES | CC1=C(COP(=O)(O)COCCn2cnc3c(=O)[nH]c(N)nc32)OC(=O)C1 |
| InChI | InChI=1S/C14H18N5O7P/c1-8-4-10(20)26-9(8)5-25-27(22,23)7-24-3-2-19-6-16-11-12(19)17-14(15)18-13(11)21/h6H,2-5,7H2,1H3,(H,22,23)(H3,15,17,18,21) |
| InChIKey | VYKMEXJXEPRPGN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|