C17H22N5O4P — CID 136953532
2-amino-9-[2-[[methyl-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953532) has the molecular formula C17H22N5O4P and a molecular weight of 391.37 g/mol. Its IUPAC name is 2-amino-9-[2-[[methyl-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[methyl-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953532 |
| Molecular Formula | C17H22N5O4P |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-amino-9-[2-[[methyl-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Cc1ccc(COP(C)(=O)COCCn2cnc3c(=O)[nH]c(N)nc32)cc1 |
| InChI | InChI=1S/C17H22N5O4P/c1-12-3-5-13(6-4-12)9-26-27(2,24)11-25-8-7-22-10-19-14-15(22)20-17(18)21-16(14)23/h3-6,10H,7-9,11H2,1-2H3,(H3,18,20,21,23) |
| InChIKey | SSDYIEZDYQQOKI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|